
CAS 1309785-77-0
:1-[(4-Chlorophenyl)methyl]-1H-pyrazole-3-carboxylic acid
Description:
1-[(4-Chlorophenyl)methyl]-1H-pyrazole-3-carboxylic acid is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a 4-chlorobenzyl group enhances its lipophilicity and may influence its biological activity. The carboxylic acid functional group contributes to its acidity and potential for forming hydrogen bonds, which can affect solubility and reactivity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential interactions with biological targets, and it may be investigated for applications in drug development. The compound's stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 1-[(4-Chlorophenyl)methyl]-1H-pyrazole-3-carboxylic acid represents a class of compounds that may have significant implications in pharmaceutical research and development.
Formula:C11H9ClN2O2
InChI:InChI=1S/C11H9ClN2O2/c12-9-3-1-8(2-4-9)7-14-6-5-10(13-14)11(15)16/h1-6H,7H2,(H,15,16)
InChI key:InChIKey=PQEHUVSYKXGIOG-UHFFFAOYSA-N
SMILES:C(N1N=C(C(O)=O)C=C1)C2=CC=C(Cl)C=C2
Synonyms:- 1H-Pyrazole-3-carboxylic acid, 1-[(4-chlorophenyl)methyl]-
- 1-[(4-Chlorophenyl)methyl]-1H-pyrazole-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.