
CAS 13098-41-4
:Decanoic acid, barium salt (2:1)
Description:
Decanoic acid, barium salt (2:1), also known as barium decanoate, is a chemical compound formed from the reaction of decanoic acid and barium hydroxide or barium oxide. It typically appears as a white to off-white powder or solid. This compound is characterized by its relatively low solubility in water, which is common for many metal salts of fatty acids, but it is more soluble in organic solvents such as alcohols and ethers. Barium decanoate is often used in various applications, including as a lubricant, stabilizer, or additive in plastics and coatings. It exhibits properties typical of fatty acid salts, such as surface-active behavior, which can enhance the dispersion of other materials. Additionally, it may have applications in the food industry, although its use is subject to regulatory standards due to the presence of barium, a heavy metal. Safety considerations are important, as barium compounds can be toxic if ingested or inhaled in significant quantities.
Formula:C10H20O2Ba
InChI:InChI=1S/C10H20O2.Ba/c1-2-3-4-5-6-7-8-9-10(11)12;/h2-9H2,1H3,(H,11,12);
InChI key:InChIKey=JJQXRJLWARWBRA-UHFFFAOYSA-N
SMILES:C(CCCCCC)CCC(O)=O.[Ba]
Synonyms:- Decanoic acid, barium salt
- Barium decanoate
- Barium caprate
- Decanoic acid, barium salt (2:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Decanoic acid, barium salt
CAS:Decanoic acid, barium salt is a biochemical.Formula:C20H38BaO4Color and Shape:SolidMolecular weight:479.84
