CAS 13098-73-2
:N''-[(1E)-(2-chlorophenyl)methylidene]carbonohydrazonic diamide
Description:
N''-[(1E)-(2-chlorophenyl)methylidene]carbonohydrazonic diamide, identified by its CAS number 13098-73-2, is a chemical compound characterized by its hydrazone functional group, which is formed from the condensation of hydrazine and an aldehyde or ketone. This compound features a 2-chlorophenyl group, indicating the presence of a chlorine atom on the phenyl ring, which can influence its reactivity and solubility. The carbonohydrazonic diamide structure suggests the presence of two amide functional groups, contributing to its potential as a ligand in coordination chemistry or as a precursor in organic synthesis. The presence of the chlorophenyl moiety may also impart specific biological activities, making it of interest in medicinal chemistry. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the overall structure. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C8H9ClN4
InChI:InChI=1/C8H9ClN4/c9-7-4-2-1-3-6(7)5-12-13-8(10)11/h1-5H,(H4,10,11,13)/b12-5+
Synonyms:- (2E)-2-(2-Chlorobenzylidene)hydrazinecarboximidamide
- hydrazinecarboximidamide, 2-[(2-chlorophenyl)methylene]-, (2E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Hydrazinecarboximidamide, 2-[(2-chlorophenyl)methylene]-
CAS:Formula:C8H9ClN4Purity:95%Color and Shape:SolidMolecular weight:196.6369Sephin1
CAS:Sephin1 (IFB-088) is reportedly a selective inhibitor of GADD34 (PPP1R15A), which is a stress-induced regulatory subunit of protein phosphatase 1 complex thatFormula:C8H9ClN4Purity:99.24% - 99.78%Color and Shape:SolidMolecular weight:196.64Sephin 1
CAS:Controlled ProductApplications Sephin 1 is a selective inhibitor of holophosphatase, a regulatory subunit of protein phosphatase 1. May be used in the prevention of protein misfolding diseases.
References Das, I. et al.: Science, 34, 239 (2015)Formula:C8H9ClN4Color and Shape:NeatMolecular weight:196.64N-{[(2-Chlorophenyl)methylidene]amino}guanidine
CAS:Guanidine is a molecule that contains a guanidinium group. It has cytotoxic effects on cancer cells and the ability to inhibit influenza virus proliferation. Guanidine also inhibits protein phosphatase activity, which may be due to its ability to dephosphorylate proteins. This drug can cause neuronal death by dephosphorylating proteins in the endoplasmic reticulum, leading to increased levels of calcium ions in the cytosol.Formula:C8H9ClN4Purity:Min. 95%Molecular weight:196.64 g/mol




