CAS 13098-76-5
:Guanosine 3′-(trihydrogen diphosphate)
Description:
Guanosine 3′-(trihydrogen diphosphate), commonly referred to as GDP, is a nucleotide that plays a crucial role in cellular metabolism and signaling. It consists of a guanine base, a ribose sugar, and a triphosphate group. The presence of the three phosphate groups allows GDP to participate in energy transfer and signal transduction processes, particularly in the context of G-proteins and second messenger systems. GDP is involved in the regulation of various biochemical pathways, including those related to cellular growth, differentiation, and apoptosis. Its structure allows for the reversible conversion to guanosine diphosphate (GDP) and guanosine triphosphate (GTP), which are essential for protein synthesis and energy metabolism. The compound is typically soluble in water and exhibits stability under physiological conditions, although it can be hydrolyzed in the presence of certain enzymes. Overall, GDP is a vital molecule in biochemistry, influencing numerous physiological processes within living organisms.
Formula:C10H15N5O11P2
InChI:InChI=1S/C10H15N5O11P2/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-5(17)6(3(1-16)24-9)25-28(22,23)26-27(19,20)21/h2-3,5-6,9,16-17H,1H2,(H,22,23)(H2,19,20,21)(H3,11,13,14,18)/t3-,5-,6-,9-/m1/s1
InChI key:InChIKey=GNKPWIYRLONLSO-UUOKFMHZSA-N
SMILES:O=C1C2=C(N(C=N2)[C@H]3[C@H](O)[C@H](OP(OP(=O)(O)O)(=O)O)[C@@H](CO)O3)NC(N)=N1
Synonyms:- Guanosine 3′-(trihydrogen pyrophosphate)
- Guanosine 3′-diphosphate
- Guanosine 3′-(trihydrogen diphosphate)
- 3′-GDP
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
