
CAS 13099-57-5
:4-Chloro-2,3-dihydro-2,2-dimethyl-1H-inden-1-one
Description:
4-Chloro-2,3-dihydro-2,2-dimethyl-1H-inden-1-one, with the CAS number 13099-57-5, is an organic compound characterized by its unique bicyclic structure, which includes a chloro substituent and a ketone functional group. This compound features a fused indene ring system, contributing to its aromatic properties, while the presence of the chloro group introduces reactivity and potential for further chemical modifications. The two methyl groups at the 2-position enhance steric hindrance, influencing its reactivity and stability. Typically, compounds of this nature exhibit moderate solubility in organic solvents and may participate in various chemical reactions, such as electrophilic substitutions or nucleophilic additions, due to the presence of the carbonyl group. Its structural characteristics suggest potential applications in organic synthesis and materials science, although specific applications may depend on further research and development. Safety data should be consulted for handling and usage, as halogenated compounds can pose health and environmental risks.
Formula:C11H11ClO
InChI:InChI=1S/C11H11ClO/c1-11(2)6-8-7(10(11)13)4-3-5-9(8)12/h3-5H,6H2,1-2H3
InChI key:InChIKey=OGWNZKBGVWCPHC-UHFFFAOYSA-N
SMILES:ClC1=C2C(C(=O)C(C)(C)C2)=CC=C1
Synonyms:- 1H-Inden-1-one, 4-chloro-2,3-dihydro-2,2-dimethyl-
- 1-Indanone, 4-chloro-2,2-dimethyl-
- 4-Chloro-2,3-dihydro-2,2-dimethyl-1H-inden-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.