CymitQuimica logo

CAS 130992-20-0

:

Acetic acid, oxo(1,3,4-thiadiazol-2-ylamino)- (9CI)

Description:
Acetic acid, oxo(1,3,4-thiadiazol-2-ylamino)-, also known by its CAS number 130992-20-0, is a chemical compound that features a thiadiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound typically exhibits characteristics associated with both acetic acid and thiadiazole derivatives, including potential acidity due to the carboxylic acid functional group and biological activity linked to the thiadiazole moiety. It may possess antimicrobial or antifungal properties, making it of interest in pharmaceutical and agricultural applications. The presence of the oxo group suggests that it may also participate in various chemical reactions, including nucleophilic attacks or coordination with metal ions. Additionally, the compound's solubility, stability, and reactivity can be influenced by the specific substituents on the thiadiazole ring and the overall molecular structure. As with many chemical substances, safety data and handling precautions should be considered when working with this compound in laboratory or industrial settings.
Formula:C4H3N3O3S
InChI:InChI=1/C4H3N3O3S/c8-2(3(9)10)6-4-7-5-1-11-4/h1H,(H,9,10)(H,6,7,8)
SMILES:c1n[nH]c(=NC(=O)C(=O)O)s1
Synonyms:
  • Oxo(1,3,4-Thiadiazol-2-Ylamino)Acetic Acid
  • 2-Oxo-2-(1,3,4-Thiadiazol-2-Ylamino)Acetic Acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.