CAS 1309932-98-6

1-[(2-Bromophenyl)methoxy]-3,5-dichlorobenzene

Description:

1-[(2-Bromophenyl)methoxy]-3,5-dichlorobenzene is an organic compound characterized by its complex aromatic structure, which includes a methoxy group and multiple halogen substituents. The presence of the bromine atom on the phenyl ring contributes to its reactivity and potential applications in various chemical reactions. The dichlorobenzene moiety indicates that there are two chlorine atoms attached to the benzene ring, which can influence the compound's physical properties, such as solubility and boiling point. This compound is likely to be a solid at room temperature, exhibiting moderate polarity due to the methoxy group, which can engage in hydrogen bonding. Its unique structure may render it useful in fields such as pharmaceuticals, agrochemicals, or materials science, where halogenated compounds often play a critical role. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks. Overall, the compound's characteristics make it a subject of interest for further research and application in synthetic chemistry.

Formula: C₁₃H₉BrCl₂O

InChI: InChI=1S/C13H9BrCl2O/c14-13-4-2-1-3-9(13)8-17-12-6-10(15)5-11(16)7-12/h1-7H,8H2

InChI key: InChIKey=AUKYUFOIVYUHHF-UHFFFAOYSA-N

SMILES: C(OC1=CC(Cl)=CC(Cl)=C1)C2=C(Br)C=CC=C2

Synonyms:

• Benzene, 1-[(2-bromophenyl)methoxy]-3,5-dichloro-
• 1-[(2-Bromophenyl)methoxy]-3,5-dichlorobenzene