CAS 1309933-02-5

4-[(3-Bromophenyl)methoxy]-1,2-dimethylbenzene

Description:

4-[(3-Bromophenyl)methoxy]-1,2-dimethylbenzene, identified by its CAS number 1309933-02-5, is an organic compound characterized by its complex aromatic structure. This substance features a methoxy group (-OCH3) attached to a benzene ring, which is further substituted with a 3-bromophenyl group, indicating the presence of a bromine atom on the aromatic ring. The compound also contains two methyl groups (-CH3) on the benzene ring, contributing to its overall hydrophobic character. The presence of bromine introduces notable electronegative properties, which can influence the compound's reactivity and interaction with other molecules. Typically, compounds of this nature may exhibit interesting biological activities and can be utilized in various applications, including pharmaceuticals and agrochemicals. Its solubility and stability in different solvents can vary, depending on the specific conditions and the presence of functional groups. Overall, this compound represents a unique combination of structural features that may lead to diverse chemical behaviors and potential applications in research and industry.

Formula: C₁₅H₁₅BrO

InChI: InChI=1S/C15H15BrO/c1-11-6-7-15(8-12(11)2)17-10-13-4-3-5-14(16)9-13/h3-9H,10H2,1-2H3

InChI key: InChIKey=ZOKBGQALABMTSI-UHFFFAOYSA-N

SMILES: O(CC1=CC(Br)=CC=C1)C2=CC(C)=C(C)C=C2

Synonyms:

• 4-[(3-Bromophenyl)methoxy]-1,2-dimethylbenzene
• Benzene, 4-[(3-bromophenyl)methoxy]-1,2-dimethyl-