CAS 1309933-80-9: 1-Bromo-3-[(4-butylphenoxy)methyl]benzene

Description:1-Bromo-3-[(4-butylphenoxy)methyl]benzene is an organic compound characterized by its bromine substituent and a butylphenoxy group attached to a benzene ring. This compound features a bromine atom at the 1-position and a 4-butylphenoxy group at the 3-position of the benzene ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. The presence of the bromine atom enhances its reactivity, making it useful in various chemical synthesis applications, including as an intermediate in the production of pharmaceuticals and agrochemicals. The butylphenoxy group adds hydrophobic characteristics, influencing its solubility and interaction with biological systems. Additionally, the compound may exhibit moderate to high stability under standard conditions, but it should be handled with care due to the potential reactivity of the bromine atom. Overall, 1-Bromo-3-[(4-butylphenoxy)methyl]benzene serves as a valuable building block in organic synthesis and materials science.

Formula:C₁₇H₁₉BrO

InChI:InChI=1S/C17H19BrO/c1-2-3-5-14-8-10-17(11-9-14)19-13-15-6-4-7-16(18)12-15/h4,6-12H,2-3,5,13H2,1H3

InChI key:InChIKey=ZBXGAEJSHGYQGO-UHFFFAOYSA-N

SMILES:BrC1=CC=CC(=C1)COC2=CC=C(C=C2)CCCC

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	3-Bromobenzyl-(4-n-butylphenyl)ether REF: 10-F393149CAS: 1309933-80-9	97.0%	- - -	Discontinued product
	1-Bromo-3-((4-butylphenoxy)methyl)benzene REF: 3D-JCC93380CAS: 1309933-80-9	Min. 95%	- - -	Discontinued product