CymitQuimica logo

CAS 1309933-99-0

:

2-[(2-Bromophenyl)methoxy]-1,3-dichlorobenzene

Description:
2-[(2-Bromophenyl)methoxy]-1,3-dichlorobenzene is an organic compound characterized by its complex structure, which includes a dichlorobenzene core substituted with a methoxy group and a bromophenyl moiety. This compound features a dichlorobenzene ring, indicating the presence of two chlorine atoms that contribute to its reactivity and physical properties. The methoxy group (-OCH3) enhances its solubility in organic solvents and can influence its electronic properties. The bromophenyl substituent introduces additional reactivity due to the presence of the bromine atom, which can participate in various chemical reactions, including nucleophilic substitutions. The compound is likely to exhibit moderate to high lipophilicity, making it relevant in fields such as pharmaceuticals and agrochemicals. Its specific applications may depend on its biological activity, stability, and interaction with other chemical entities. Safety data and handling precautions should be considered due to the presence of halogenated compounds, which can pose environmental and health risks.
Formula:C13H9BrCl2O
InChI:InChI=1S/C13H9BrCl2O/c14-10-5-2-1-4-9(10)8-17-13-11(15)6-3-7-12(13)16/h1-7H,8H2
InChI key:InChIKey=DTZHPBYBHUPGJH-UHFFFAOYSA-N
SMILES:O(CC1=C(Br)C=CC=C1)C2=C(Cl)C=CC=C2Cl
Synonyms:
  • Benzene, 2-[(2-bromophenyl)methoxy]-1,3-dichloro-
  • 2-[(2-Bromophenyl)methoxy]-1,3-dichlorobenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.