CAS 130995-13-0: 3-[2-(Trimethylsilyl)ethynyl]thiophene
Description:3-[2-(Trimethylsilyl)ethynyl]thiophene is an organosilicon compound characterized by its unique structure, which includes a thiophene ring and a trimethylsilyl group attached via an ethynyl linkage. The presence of the thiophene moiety imparts notable electronic properties, making it useful in organic electronics and materials science. The trimethylsilyl group enhances the compound's solubility and stability, while also influencing its reactivity and interaction with other chemical species. This compound typically exhibits good thermal stability and can participate in various chemical reactions, including cross-coupling and polymerization processes. Its applications may extend to the development of conductive polymers, organic light-emitting diodes (OLEDs), and photovoltaic devices. Additionally, the presence of the ethynyl group allows for further functionalization, making it a versatile building block in synthetic organic chemistry. Overall, 3-[2-(Trimethylsilyl)ethynyl]thiophene is a significant compound in the field of materials chemistry, particularly in the development of advanced electronic materials.
Formula:C9H12SSi
InChI:InChI=1S/C9H12SSi/c1-11(2,3)7-5-9-4-6-10-8-9/h4,6,8H,1-3H3
InChI key:InChIKey=XJUQFUWWPCIZRB-UHFFFAOYSA-N
SMILES:C(#C[Si](C)(C)C)C1=CSC=C1
- Synonyms:
- 3-((Trimethylsilyl)Ethynyl)Thiophene
- 3-[2-(Trimethylsilyl)ethynyl]thiophene
- Silane, trimethyl(3-thienylethynyl)-
- Thiophene, 3-[2-(trimethylsilyl)ethynyl]-
- Trimethyl(thien-3-ylethynyl)silane

3-(Trimethylsilylethynyl)thiophene
Ref: 3B-T3190
1g | 44.00 € | ||
5g | 137.00 € |

Thiophene, 3-[2-(trimethylsilyl)ethynyl]-
Ref: IN-DA000V8G
1g | 46.00 € | ||
5g | 120.00 € | ||
10g | 179.00 € | ||
250mg | 26.00 € |

Ref: 54-OR96161
1g | 36.00 € | ||
5g | 91.00 € | ||
25g | 369.00 € | ||
100g | 1,250.00 € | ||
250mg | 32.00 € |

(3-Thienylethynyl)trimethylsilane
Ref: 10-F068557
1g | 32.00 € | ||
5g | 83.00 € | ||
10g | 138.00 € |

3-(Trimethylsilylethynyl)thiophene
Ref: 3D-FT153215
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
500mg | Discontinued | Request information |