CymitQuimica logo

CAS 1309955-15-4

:

3,4-Dihydro-5-phenyl-1(2H)-isoquinolinone

Description:
3,4-Dihydro-5-phenyl-1(2H)-isoquinolinone is a chemical compound characterized by its isoquinolinone structure, which features a bicyclic system comprising a benzene ring fused to a pyridine-like ring. This compound typically exhibits a molecular formula that reflects its complex structure, including multiple carbon, hydrogen, and nitrogen atoms. It is known for its potential biological activity, which may include effects on various biological pathways, making it of interest in medicinal chemistry and drug development. The presence of the phenyl group contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological membranes. Additionally, the dihydro form indicates that it has two hydrogen atoms added to the isoquinoline structure, which can affect its reactivity and stability. As with many organic compounds, its properties such as melting point, boiling point, and solubility can vary based on environmental conditions and the presence of other substances. Overall, 3,4-Dihydro-5-phenyl-1(2H)-isoquinolinone represents a unique scaffold for further research in pharmacology and organic synthesis.
Formula:C15H13NO
InChI:InChI=1S/C15H13NO/c17-15-14-8-4-7-12(13(14)9-10-16-15)11-5-2-1-3-6-11/h1-8H,9-10H2,(H,16,17)
InChI key:InChIKey=LZDKSVWIIDLVQF-UHFFFAOYSA-N
SMILES:O=C1C=2C(=C(C=CC2)C3=CC=CC=C3)CCN1
Synonyms:
  • 1(2H)-Isoquinolinone, 3,4-dihydro-5-phenyl-
  • 3,4-Dihydro-5-phenyl-1(2H)-isoquinolinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.