CymitQuimica logo

CAS 1309980-77-5

:

N-[2-Chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-2,2-dimethylpropanamide

Description:
N-[2-Chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-2,2-dimethylpropanamide is a chemical compound characterized by its complex structure, which includes a pyridine ring, a chloro substituent, and a boron-containing moiety. The presence of the dioxaborolane group suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of boron-containing compounds that can participate in various chemical reactions. The compound's amide functional group indicates it may exhibit properties typical of amides, such as hydrogen bonding capabilities and potential solubility in polar solvents. Its specific structural features may contribute to its biological activity, making it of interest in pharmaceutical research. Additionally, the presence of the tetramethyl groups enhances steric hindrance, which can influence the compound's reactivity and interactions with biological targets. Overall, this compound represents a unique combination of functional groups that may offer diverse applications in chemical and medicinal fields.
Formula:C16H24BClN2O3
InChI:InChI=1S/C16H24BClN2O3/c1-14(2,3)13(21)19-10-8-9-11(20-12(10)18)17-22-15(4,5)16(6,7)23-17/h8-9H,1-7H3,(H,19,21)
InChI key:InChIKey=XBJPONGDNPXIAL-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2N=C(Cl)C(NC(C(C)(C)C)=O)=CC2
Synonyms:
  • N-[2-Chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-2,2-dimethylpropanamide
  • Propanamide, N-[2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-2,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.