
CAS 1309980-96-8
:B-[2-Bromo-3-(trifluoromethoxy)phenyl]boronic acid
Description:
B-[2-Bromo-3-(trifluoromethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. The compound features a bromine atom and a trifluoromethoxy group attached to a phenyl ring, contributing to its unique reactivity and potential applications in cross-coupling reactions, such as Suzuki-Miyaura coupling. The trifluoromethoxy group enhances the compound's electronic properties, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the presence of the boronic acid moiety allows for the formation of stable complexes with various substrates, facilitating its use in the development of sensors and catalysts. Overall, this compound exemplifies the versatility of boronic acids in synthetic chemistry, particularly in the context of functionalized aromatic compounds.
Formula:C7H5BBrF3O3
InChI:InChI=1S/C7H5BBrF3O3/c9-6-4(8(13)14)2-1-3-5(6)15-7(10,11)12/h1-3,13-14H
InChI key:InChIKey=RIXLLVIGWOPVSW-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=C(Br)C(B(O)O)=CC=C1
Synonyms:- Boronic acid, B-[2-bromo-3-(trifluoromethoxy)phenyl]-
- B-[2-Bromo-3-(trifluoromethoxy)phenyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Boronic acid, B-[2-bromo-3-(trifluoromethoxy)phenyl]-
CAS:Formula:C7H5BBrF3O3Molecular weight:284.8230
