CAS 1309981-35-8
:B-[6-(Cyclobutylamino)-2-pyridinyl]boronic acid
Description:
B-[6-(Cyclobutylamino)-2-pyridinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that is further substituted with a cyclobutylamino group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. The presence of the cyclobutylamino moiety may influence its solubility, reactivity, and biological activity. Generally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in organic synthesis for forming carbon-carbon bonds. Additionally, the specific structure of this compound may impart unique characteristics, such as potential interactions with biological targets, which could be explored for therapeutic applications. Its CAS number, 1309981-35-8, allows for precise identification in chemical databases and literature. Overall, this compound represents a valuable tool in both synthetic and medicinal chemistry contexts.
Formula:C9H13BN2O2
InChI:InChI=1S/C9H13BN2O2/c13-10(14)8-5-2-6-9(12-8)11-7-3-1-4-7/h2,5-7,13-14H,1,3-4H2,(H,11,12)
InChI key:InChIKey=NOMBXXLSWJWVRD-UHFFFAOYSA-N
SMILES:N(C=1N=C(B(O)O)C=CC1)C2CCC2
Synonyms:- B-[6-(Cyclobutylamino)-2-pyridinyl]boronic acid
- Boronic acid, B-[6-(cyclobutylamino)-2-pyridinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
