CymitQuimica logo

CAS 1309981-36-9

:

N-Cyclopropyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine

Description:
N-Cyclopropyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine is a chemical compound characterized by its unique structural features, which include a cyclopropyl group and a dioxaborolane moiety. The presence of the pyridinamine core suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The dioxaborolane group is known for its role in facilitating chemical reactions, particularly in organoboron chemistry, making this compound potentially useful in synthetic applications. Its molecular structure may impart specific physical properties, such as solubility and stability, which are critical for its functionality in various chemical environments. Additionally, the presence of the tetramethyl substituents enhances steric hindrance, which can influence reactivity and selectivity in chemical reactions. Overall, this compound exemplifies the intersection of organic synthesis and medicinal chemistry, with implications for drug design and development.
Formula:C14H21BN2O2
InChI:InChI=1S/C14H21BN2O2/c1-13(2)14(3,4)19-15(18-13)11-6-5-7-12(17-11)16-10-8-9-10/h5-7,10H,8-9H2,1-4H3,(H,16,17)
InChI key:InChIKey=MCNPFKACURQVIE-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2N=C(NC3CC3)C=CC2
Synonyms:
  • N-Cyclopropyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine
  • 2-Pyridinamine, N-cyclopropyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.