CymitQuimica logo

CAS 1309981-37-0

:

Ethyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinecarboxylate

Description:
Ethyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinecarboxylate is a chemical compound characterized by its unique structure, which includes a pyridine ring and a dioxaborolane moiety. This compound typically exhibits properties associated with both the pyridine and boron-containing functional groups, such as moderate polarity and potential reactivity in various chemical reactions, including cross-coupling reactions commonly used in organic synthesis. The presence of the ethyl ester group suggests it may have solubility in organic solvents and could participate in esterification or hydrolysis reactions. Additionally, the tetramethyl dioxaborolane component may confer specific reactivity patterns, particularly in organoboron chemistry, making it useful in synthetic applications. The compound's molecular structure may also influence its stability, boiling point, and melting point, which are important for practical applications. Overall, this compound is of interest in the field of organic chemistry, particularly in the development of new synthetic methodologies and materials.
Formula:C14H20BNO4
InChI:InChI=1S/C14H20BNO4/c1-6-18-12(17)10-8-7-9-11(16-10)15-19-13(2,3)14(4,5)20-15/h7-9H,6H2,1-5H3
InChI key:InChIKey=PIZVNHYTAHMGDO-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2N=C(C(OCC)=O)C=CC2
Synonyms:
  • 2-Pyridinecarboxylic acid, 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, ethyl ester
  • Ethyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.