
CAS 1309981-40-5
:3-Fluoro-4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Description:
3-Fluoro-4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a chemical compound characterized by its pyridine ring, which is substituted at the 3-position with a fluorine atom and at the 4-position with a methyl group. Additionally, it features a boron-containing moiety, specifically a tetramethyl-1,3,2-dioxaborolane, which is attached to the 2-position of the pyridine ring. This compound is notable for its potential applications in organic synthesis and medicinal chemistry, particularly in the development of boron-containing compounds that can serve as intermediates or catalysts. The presence of the fluorine atom may enhance its reactivity and influence its electronic properties, while the dioxaborolane group can facilitate various chemical transformations. Overall, this compound exemplifies the integration of heterocyclic chemistry with organoboron chemistry, making it a subject of interest for researchers in the field.
Formula:C12H17BFNO2
InChI:InChI=1S/C12H17BFNO2/c1-8-6-7-15-10(9(8)14)13-16-11(2,3)12(4,5)17-13/h6-7H,1-5H3
InChI key:InChIKey=HBQOOGMBFTUQDB-UHFFFAOYSA-N
SMILES:FC1=C(B2OC(C)(C)C(C)(C)O2)N=CC=C1C
Synonyms:- Pyridine, 3-fluoro-4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 3-Fluoro-4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Fluoro-4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
CAS:Formula:C12H17BFNO2Molecular weight:237.0783

