CymitQuimica logo

CAS 1309981-66-5

:

2-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine

Description:
2-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine is an organic compound characterized by its unique structure, which includes a pyrazine ring substituted with a fluorine atom and a dioxaborolane moiety. The presence of the fluorine atom enhances its reactivity and potential applications in medicinal chemistry and material science. The dioxaborolane group contributes to its stability and solubility in various solvents, making it useful in synthetic chemistry, particularly in cross-coupling reactions. This compound is likely to exhibit moderate to high polarity due to the electronegative fluorine and the boron-containing group, influencing its interactions with other molecules. Additionally, the steric hindrance provided by the tetramethyl groups can affect its reactivity and selectivity in chemical reactions. Overall, 2-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine is a versatile compound with potential applications in pharmaceuticals and organic synthesis, owing to its distinctive functional groups and structural characteristics.
Formula:C10H14BFN2O2
InChI:InChI=1S/C10H14BFN2O2/c1-9(2)10(3,4)16-11(15-9)7-5-14-8(12)6-13-7/h5-6H,1-4H3
InChI key:InChIKey=JNZFRBRJZKQLIW-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=NC(F)=CN2
Synonyms:
  • 2-Fluoro-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine
  • Pyrazine, 2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 2-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.