CAS 1309982-28-2
:2-(2-Methyl-1-piperidinyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Description:
2-(2-Methyl-1-piperidinyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a piperidine moiety and a boron-containing dioxaborolane group. The presence of the piperidine ring contributes to its potential biological activity, as piperidines are often found in various pharmaceuticals. The dioxaborolane group is notable for its ability to form stable complexes with various substrates, making this compound potentially useful in organic synthesis and medicinal chemistry. The compound's molecular structure suggests it may exhibit unique reactivity patterns, particularly in cross-coupling reactions, due to the boron atom. Additionally, the presence of multiple methyl groups enhances its lipophilicity, which can influence its solubility and permeability in biological systems. Overall, this compound's unique features make it a subject of interest in research areas such as drug development and materials science.
Formula:C17H27BN2O2
InChI:InChI=1S/C17H27BN2O2/c1-13-9-6-7-12-20(13)15-11-8-10-14(19-15)18-21-16(2,3)17(4,5)22-18/h8,10-11,13H,6-7,9,12H2,1-5H3
InChI key:InChIKey=HLWDXMUNKIFABA-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2N=C(C=CC2)N3C(C)CCCC3
Synonyms:- Pyridine, 2-(2-methyl-1-piperidinyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 2-(2-Methyl-1-piperidinyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(2-Methylpiperidin-1-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
CAS:Formula:C17H27BN2O2Molecular weight:302.2195
