CAS 1309982-30-6
:B-(6-Propoxy-2-pyridinyl)boronic acid
Description:
B-(6-Propoxy-2-pyridinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that is further substituted with a propoxy group. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the pyridine moiety contributes to its potential as a ligand in coordination chemistry and its role in biological systems, particularly in the context of enzyme inhibition. Additionally, the propoxy group enhances its solubility in organic solvents, which can be advantageous for its application in synthetic reactions. B-(6-Propoxy-2-pyridinyl)boronic acid may also exhibit unique reactivity patterns due to the electronic effects of the substituents on the pyridine ring, influencing its behavior in chemical reactions. Overall, this compound is of interest in both academic research and industrial applications due to its versatile chemical properties.
Formula:C8H12BNO3
InChI:InChI=1S/C8H12BNO3/c1-2-6-13-8-5-3-4-7(10-8)9(11)12/h3-5,11-12H,2,6H2,1H3
InChI key:InChIKey=XXYWGWJXKVWRCW-UHFFFAOYSA-N
SMILES:O(CCC)C=1N=C(B(O)O)C=CC1
Synonyms:- Boronic acid, B-(6-propoxy-2-pyridinyl)-
- B-(6-Propoxy-2-pyridinyl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
