CymitQuimica logo

CAS 1309982-31-7

:

2-Propoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine

Description:
2-Propoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is an organic compound characterized by its unique structure, which includes a pyridine ring substituted with a propoxy group and a dioxaborolane moiety. The presence of the pyridine ring imparts basicity and potential for coordination with metal ions, while the propoxy group enhances solubility in organic solvents. The dioxaborolane component is notable for its boron content, which can facilitate various chemical reactions, including cross-coupling reactions in organic synthesis. This compound may exhibit properties such as moderate polarity and potential reactivity due to the functional groups present. Its applications could span areas such as medicinal chemistry, materials science, and catalysis, particularly in the development of boron-containing compounds. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, 2-Propoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine represents a versatile structure with implications in various chemical research fields.
Formula:C14H22BNO3
InChI:InChI=1S/C14H22BNO3/c1-6-10-17-12-9-7-8-11(16-12)15-18-13(2,3)14(4,5)19-15/h7-9H,6,10H2,1-5H3
InChI key:InChIKey=RUFBPIVFNFVUIW-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2N=C(OCCC)C=CC2
Synonyms:
  • 2-Propoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
  • Pyridine, 2-propoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 2-Propoxy-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.