
CAS 1309982-35-1
:Methyl 2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-pyridinecarboxylate
Description:
Methyl 2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-pyridinecarboxylate is an organic compound characterized by its complex structure, which includes a pyridine ring and a boron-containing moiety. The presence of the pyridine ring imparts basic properties, while the carboxylate group contributes to its potential reactivity and solubility in polar solvents. The dioxaborolane group enhances its stability and may facilitate reactions involving boron, such as cross-coupling reactions in organic synthesis. This compound is likely to be used in various applications, including medicinal chemistry and materials science, due to its unique structural features. Its synthesis typically involves multi-step organic reactions, and it may exhibit interesting biological activities or serve as a building block in the development of more complex molecules. As with many boron-containing compounds, it may also exhibit specific coordination chemistry, making it valuable in catalysis or as a ligand in coordination complexes. Safety and handling precautions should be observed, as with all chemical substances, due to potential reactivity and toxicity.
Formula:C14H20BNO4
InChI:InChI=1S/C14H20BNO4/c1-9-7-10(12(17)18-6)8-11(16-9)15-19-13(2,3)14(4,5)20-15/h7-8H,1-6H3
InChI key:InChIKey=KZRUJMUSRFQBBV-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC(C(OC)=O)=CC(C)=N2
Synonyms:- 4-Pyridinecarboxylic acid, 2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, methyl ester
- Methyl 2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-pyridinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isonicotinate
CAS:Formula:C14H20BNO4Molecular weight:277.1239
