CymitQuimica logo

CAS 1309982-51-1

:

B-[2-(3-Methyl-1-piperidinyl)-4-thiazolyl]boronic acid

Description:
B-[2-(3-Methyl-1-piperidinyl)-4-thiazolyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and other nucleophiles. This compound features a thiazole ring, which contributes to its biological activity, and a piperidine moiety that enhances its solubility and interaction with biological targets. The presence of the methyl group on the piperidine ring can influence the compound's lipophilicity and overall pharmacokinetic properties. Boronic acids are often utilized in medicinal chemistry for their role in drug design, particularly in the development of proteasome inhibitors and other therapeutic agents. Additionally, this compound may exhibit potential applications in organic synthesis and materials science due to its unique reactivity and structural properties. Its specific interactions and efficacy would depend on the context of its use, including the target biological systems and conditions under which it is applied.
Formula:C9H15BN2O2S
InChI:InChI=1S/C9H15BN2O2S/c1-7-3-2-4-12(5-7)9-11-8(6-15-9)10(13)14/h6-7,13-14H,2-5H2,1H3
InChI key:InChIKey=DIIUKFDPKPMRCW-UHFFFAOYSA-N
SMILES:B(O)(O)C=1N=C(SC1)N2CC(C)CCC2
Synonyms:
  • Boronic acid, B-[2-(3-methyl-1-piperidinyl)-4-thiazolyl]-
  • B-[2-(3-Methyl-1-piperidinyl)-4-thiazolyl]boronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.