CAS 1309982-65-7
:1,1-Dimethylethyl N-[6-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]carbamate
Description:
1,1-Dimethylethyl N-[6-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]carbamate, identified by its CAS number 1309982-65-7, is a chemical compound that features a complex structure incorporating a pyridine ring, a carbamate functional group, and a boron-containing moiety. The presence of the methoxy group and the dimethyl substituents contribute to its potential solubility and reactivity. This compound is likely to exhibit specific biological activities, possibly related to its use in agricultural chemistry or medicinal chemistry, given the presence of the pyridine and carbamate functionalities, which are often associated with herbicidal or pharmaceutical properties. The boron-containing group may enhance its stability or reactivity in certain chemical reactions. As with many organic compounds, its physical properties such as melting point, boiling point, and solubility would depend on the specific conditions and purity of the sample. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.
Formula:C17H27BN2O5
InChI:InChI=1S/C17H27BN2O5/c1-15(2,3)23-14(21)20-11-9-12(13(22-8)19-10-11)18-24-16(4,5)17(6,7)25-18/h9-10H,1-8H3,(H,20,21)
InChI key:InChIKey=YXKLQBQOGNKZGB-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=C(NC(OC(C)(C)C)=O)C=N1)B2OC(C)(C)C(C)(C)O2
Synonyms:- Carbamic acid, N-[6-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-[6-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl (6-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)carbamate
CAS:Formula:C17H27BN2O5Molecular weight:350.2177
