CymitQuimica logo

CAS 1309982-68-0

:

3-Fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine

Description:
3-Fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is an organic compound characterized by its unique structure, which includes a pyridine ring substituted with a fluorine atom and a dioxaborolane moiety. The presence of the fluorine atom enhances its reactivity and can influence its electronic properties, making it useful in various chemical applications. The dioxaborolane group contributes to the compound's stability and solubility in organic solvents, while also serving as a potential precursor for further chemical transformations, particularly in cross-coupling reactions. This compound is of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block in organic synthesis. Its specific properties, such as melting point, boiling point, and solubility, would depend on the conditions and the presence of other functional groups in the environment. Overall, 3-Fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine exemplifies the versatility of organofluorine compounds in modern chemistry.
Formula:C11H15BFNO2
InChI:InChI=1S/C11H15BFNO2/c1-10(2)11(3,4)16-12(15-10)9-8(13)6-5-7-14-9/h5-7H,1-4H3
InChI key:InChIKey=AWVXCKXEBKQHMB-UHFFFAOYSA-N
SMILES:FC1=C(B2OC(C)(C)C(C)(C)O2)N=CC=C1
Synonyms:
  • 3-Fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
  • Pyridine, 3-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 2-(3-Fluoropyridin-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.