
CAS 131-04-4
:Dibenzo[a,g]quinolizinium, 5,6-dihydro-2,3,9,10-tetramethoxy-, hydroxide (1:1)
Description:
Dibenzo[a,g]quinolizinium, 5,6-dihydro-2,3,9,10-tetramethoxy-, hydroxide (1:1), with CAS number 131-04-4, is a complex organic compound characterized by its unique polycyclic structure, which includes fused benzene rings and a quinolizinium moiety. This compound typically exhibits a deep color, often associated with its conjugated system, which can contribute to its optical properties. The presence of methoxy groups enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. As a hydroxide salt, it can participate in acid-base reactions, and its stability can be affected by environmental conditions such as pH and temperature. Dibenzo[a,g]quinolizinium derivatives are of interest in various fields, including organic synthesis, materials science, and potentially in medicinal chemistry due to their biological activity. However, specific applications and safety profiles should be evaluated based on further research and context.
Formula:C21H22NO4·HO
InChI:InChI=1S/C21H22NO4.H2O/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4;/h5-6,9-12H,7-8H2,1-4H3;1H2/q+1;/p-1
InChI key:InChIKey=FQXRAAFEBRSBND-UHFFFAOYSA-M
SMILES:O(C)C=1C=C2C=3[N+](=CC=4C(C3)=CC=C(OC)C4OC)CCC2=CC1OC.[OH-]
Synonyms:- Dibenzo[a,g]quinolizinium, 5,6-dihydro-2,3,9,10-tetramethoxy-, hydroxide (1:1)
- Dibenzo[a,g]quinolizinium, 5,6-dihydro-2,3,9,10-tetramethoxy-, hydroxide
- Palmatine hydroxide
- Palmatinium hydroxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Palmatine hydroxide
CAS:Palmatine hydroxide: oral IDO-1 inhibitor (IC50: 3-157μM), targets WNV protease, has anti-cancer/viral and neuroprotective properties.Formula:C21H23NO5Color and Shape:SolidMolecular weight:369.41
