CymitQuimica logo

CAS 131-43-1

:

2-[4-[2-(4-Nitro-2-sulfophenyl)ethenyl]-3-sulfophenyl]-2H-naphtho[1,2-d]triazole-5-sulfonic acid

Description:
The chemical substance known as 2-[4-[2-(4-Nitro-2-sulfophenyl)ethenyl]-3-sulfophenyl]-2H-naphtho[1,2-d]triazole-5-sulfonic acid, with CAS number 131-43-1, is a synthetic organic compound characterized by its complex structure, which includes multiple sulfonic acid groups and a nitro group. This compound is typically used as a dye or pigment due to its ability to absorb light in specific wavelengths, making it valuable in various applications, including textiles and biological staining. Its solubility in water is enhanced by the presence of sulfonic acid groups, which also contribute to its ionic nature. The presence of the nitro group may impart additional properties, such as increased reactivity or specific interactions with biological molecules. Overall, this compound is notable for its vibrant color and potential utility in analytical chemistry and materials science, particularly in contexts where fluorescent or colorimetric responses are desired. Safety and handling precautions are essential due to the presence of the nitro group, which can pose health risks.
Formula:C24H16N4O11S3
InChI:InChI=1S/C24H16N4O11S3/c29-28(30)17-10-8-15(22(12-17)41(34,35)36)6-5-14-7-9-16(11-21(14)40(31,32)33)27-25-20-13-23(42(37,38)39)18-3-1-2-4-19(18)24(20)26-27/h1-13H,(H,31,32,33)(H,34,35,36)(H,37,38,39)
InChI key:InChIKey=ZUALTTRSCLAGBQ-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C=1C=2C(C=3C(=NN(N3)C4=CC(S(=O)(=O)O)=C(C=CC5=C(S(=O)(=O)O)C=C(N(=O)=O)C=C5)C=C4)C1)=CC=CC2
Synonyms:
  • 2-[4-[2-(4-Nitro-2-sulphophenyl)vinyl]-3-sulphophenyl]-2H-naphtho[1,2-d]triazole-5-sulphonic acid
  • 2,2′-Stilbenedisulfonic acid, 4-nitro-4′-(5-sulfo-2H-naphtho[1,2-d]triazol-2-yl)-
  • 2-[4-[2-(4-Nitro-2-sulfophenyl)ethenyl]-3-sulfophenyl]-2H-naphtho[1,2-d]triazole-5-sulfonic acid
  • 4-Nitro-4′-(5-sulfo-2H-naphtho[1,2-d]triazol-2-yl)-2,2′-stilbenedisulfonic acid
  • 2H-Naphtho[1,2-d]triazole-5-sulfonic acid, 2-[4-[2-(4-nitro-2-sulfophenyl)ethenyl]-3-sulfophenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.