CAS 131-83-9
:2′-Uridylic acid
Description:
2′-Uridylic acid, also known as uridine monophosphate (UMP), is a nucleotide that plays a crucial role in cellular metabolism and the synthesis of RNA. It consists of a uracil base, a ribose sugar, and a phosphate group. UMP is a key building block for RNA synthesis, serving as a precursor for the synthesis of other nucleotides and nucleic acids. It is soluble in water and exhibits a polar nature due to its phosphate group, which contributes to its role in biochemical reactions. UMP is involved in various metabolic pathways, including the synthesis of glycogen and the metabolism of carbohydrates. Additionally, it can act as a signaling molecule and is implicated in cellular processes such as energy transfer and regulation of enzyme activity. In biological systems, UMP can be phosphorylated to form UDP and UTP, which are essential for various biosynthetic reactions. Overall, 2′-Uridylic acid is vital for maintaining cellular functions and supporting the synthesis of genetic material.
Formula:C9H13N2O9P
InChI:InChI=1S/C9H13N2O9P/c12-3-4-6(14)7(20-21(16,17)18)8(19-4)11-2-1-5(13)10-9(11)15/h1-2,4,6-8,12,14H,3H2,(H,10,13,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1
InChI key:InChIKey=HQIDPEYTETUCNF-XVFCMESISA-N
SMILES:O(P(=O)(O)O)[C@H]1[C@@H](O[C@H](CO)[C@H]1O)N2C(=O)NC(=O)C=C2
Synonyms:- 2′-Uridylic acid
- 2′-Phosphouridine
- 2′-UMP
- Uridine 2′-phosphate
- Uridine 2′-monophosphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
