CymitQuimica logo

CAS 131-88-4

:

Benzene, 1,1′-(1,2-diethyl-3-methylene-1,3-propanediyl)bis[4-methoxy-

Description:
The chemical substance known as Benzene, 1,1′-(1,2-diethyl-3-methylene-1,3-propanediyl)bis[4-methoxy-] is a complex organic compound characterized by its structure, which includes a benzene ring and various substituents. The presence of the methoxy groups indicates that it has ether functionalities, which can influence its reactivity and solubility. The diethyl and methylene groups contribute to its hydrophobic nature, making it less soluble in water but more soluble in organic solvents. This compound is likely to exhibit aromatic properties due to the benzene ring, which can participate in electrophilic substitution reactions. Its molecular structure suggests potential applications in organic synthesis, possibly as an intermediate in the production of more complex molecules. Additionally, the presence of multiple functional groups may impart unique physical properties, such as specific melting and boiling points, as well as distinct spectroscopic characteristics. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact.
Formula:C22H28O2
InChI:InChI=1S/C22H28O2/c1-6-21(16(3)17-8-12-19(23-4)13-9-17)22(7-2)18-10-14-20(24-5)15-11-18/h8-15,21-22H,3,6-7H2,1-2,4-5H3
InChI key:InChIKey=DSVIJUQMZBIDOE-UHFFFAOYSA-N
SMILES:C(C(C(=C)C1=CC=C(OC)C=C1)CC)(CC)C2=CC=C(OC)C=C2
Synonyms:
  • 1-Hexene, 3-ethyl-2,4-bis(p-methoxyphenyl)-
  • Benzene, 1,1′-(1,2-diethyl-3-methylene-1,3-propanediyl)bis[4-methoxy-
  • 3-Ethyl-2,4-bis(p-methoxyphenyl)-1-hexene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.