
CAS 131001-87-1
:Methyl 4-chloro-2-ethenylbenzoate
Description:
Methyl 4-chloro-2-ethenylbenzoate, with the CAS number 131001-87-1, is an organic compound characterized by its ester functional group, which is derived from benzoic acid. This compound features a methyl ester group and a chloro substituent on the aromatic ring, contributing to its unique chemical properties. The presence of the ethenyl group introduces a double bond, which can participate in various chemical reactions, such as polymerization or addition reactions. Methyl 4-chloro-2-ethenylbenzoate is typically a colorless to pale yellow liquid with a distinct odor, and it is soluble in organic solvents. Its reactivity is influenced by the electron-withdrawing nature of the chloro group, which can enhance electrophilic substitution reactions on the aromatic ring. This compound may be utilized in organic synthesis, particularly in the production of more complex molecules or as an intermediate in various chemical processes. Safety precautions should be observed when handling this substance, as it may pose health risks if inhaled or ingested.
Formula:C10H9ClO2
InChI:InChI=1S/C10H9ClO2/c1-3-7-6-8(11)4-5-9(7)10(12)13-2/h3-6H,1H2,2H3
InChI key:InChIKey=SJLJTKMNCJWSNG-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(C=C)C=C(Cl)C=C1
Synonyms:- Benzoic acid, 4-chloro-2-ethenyl-, methyl ester
- 2-Methoxycarbonyl-5-chlorostyrene
- Methyl 4-chloro-2-ethenylbenzoate
- Methyl 4-chloro-2-vinylbenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.