CAS 131002-09-0

6-Chloro-1(2H)-isoquinolinone

Description:

6-Chloro-1(2H)-isoquinolinone is a heterocyclic organic compound characterized by its isoquinoline structure, which features a fused benzene and pyridine ring system. The presence of a chlorine atom at the 6-position contributes to its unique reactivity and potential biological activity. This compound typically exhibits a pale yellow to off-white crystalline appearance and is soluble in organic solvents, such as dimethyl sulfoxide (DMSO) and ethanol, but may have limited solubility in water. Its molecular structure allows for various functional group interactions, making it of interest in medicinal chemistry and drug development. The compound may exhibit pharmacological properties, including antimicrobial or anticancer activities, although specific biological effects would depend on further empirical studies. Additionally, its synthesis and characterization involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. As with many chlorinated compounds, safety precautions should be observed due to potential toxicity and environmental impact.

Formula: C₉H₆ClNO

InChI: InChI=1S/C9H6ClNO/c10-7-1-2-8-6(5-7)3-4-11-9(8)12/h1-5H,(H,11,12)

SMILES: c1cc2c(cc[nH]c2=O)cc1Cl

1(2H)-Isoquinolinone, 6-chloro-

CAS: 131002-09-0

Formula: C₉H₆ClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 179.6030

Ref: IN-DA000VBJ

6-Chloroisoquinolin-1-ol

CAS: 131002-09-0

6-Chloroisoquinolin-1-ol

Purity: 98%

Molecular weight: 179.60g/mol

Ref: 54-OR917233

6-CHLOROISOQUINOLIN-1-OL

CAS: 131002-09-0

Formula: C₉H₆ClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 179.6

Ref: 10-F306820

6-Chloroisoquinolin-1-ol

CAS: 131002-09-0

Versatile small molecule scaffold

Formula: C₉H₆ClNO

Purity: Min. 95%

Molecular weight: 179.61 g/mol

Ref: 3D-GFA00209