
CAS 131004-94-9
:Pentanoic acid, 5-hydroxy-, homopolymer
Description:
Pentanoic acid, 5-hydroxy-, homopolymer, with the CAS number 131004-94-9, is a synthetic polymer derived from the polymerization of pentanoic acid and its hydroxy derivative. This substance exhibits characteristics typical of polycarboxylic acids, including a high degree of polarity due to the presence of carboxylic acid groups, which can facilitate hydrogen bonding and enhance solubility in polar solvents. The polymer's structure contributes to its potential applications in various fields, including coatings, adhesives, and as a modifier in plastics. Its hydrophilic nature may also impart biocompatibility, making it suitable for biomedical applications. Additionally, the presence of hydroxyl groups can enhance reactivity, allowing for further functionalization or cross-linking with other materials. The thermal stability and mechanical properties of this homopolymer can vary depending on its molecular weight and degree of polymerization, influencing its performance in practical applications. Overall, pentanoic acid, 5-hydroxy-, homopolymer represents a versatile material with potential uses across multiple industries.
Formula:(C5H10O3)x
InChI:InChI=1S/C5H10O3/c6-4-2-1-3-5(7)8/h6H,1-4H2,(H,7,8)
InChI key:InChIKey=PHOJOSOUIAQEDH-UHFFFAOYSA-N
SMILES:C(CCCO)C(O)=O
Synonyms:- Poly(ω-hydroxypentanoic acid)
- Poly(5-hydroxyvalerate)
- Poly(5-Hydroxypentanoate)
- 5-Hydroxyvaleric acid homopolymer
- Pentanoic acid, 5-hydroxy-, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
