CAS 13101-40-1

1-BROMO-3-CHLORO-5-IODOBENZENE

Description:

1-Bromo-3-chloro-5-iodobenzene, with the CAS number 13101-40-1, is an aromatic halogenated compound characterized by the presence of three different halogen substituents on a benzene ring. Specifically, it features a bromine atom at the first position, a chlorine atom at the third position, and an iodine atom at the fifth position of the benzene ring. This compound is typically a solid at room temperature and may exhibit a crystalline structure. Its molecular formula reflects the presence of carbon, hydrogen, and halogen atoms, contributing to its unique chemical properties. The presence of multiple halogens can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit interesting physical properties such as solubility in organic solvents and varying melting and boiling points, influenced by the nature and position of the substituents. Its halogenated nature may also impart specific biological activities, making it of interest in fields such as medicinal chemistry and materials science.

Formula: C₆H₃BrClI

InChI: InChI=1/C6H3BrClI/c7-4-1-5(8)3-6(9)2-4/h1-3H

SMILES: c1c(cc(cc1Cl)I)Br

Synonyms:

• Benzene, 1-Bromo-3-Chloro-5-Iodo-
• Benzene, 3-bromo-5-chloro-1-iodo-
• 3-Chloro-5-iodo-1-bromobenzene

1-Bromo-3-chloro-5-iodobenzene

CAS: 13101-40-1

Formula: C₆H₃BrClI

Purity: >97.0%(GC)

Color and Shape: White to Brown powder to crystal

Molecular weight: 317.35

Ref: 3B-B4981

Benzene, 1-bromo-3-chloro-5-iodo-

CAS: 13101-40-1

Formula: C₆H₃BrClI

Purity: 97%

Color and Shape: Solid

Molecular weight: 317.3495

Ref: IN-DA000VBW

3-Bromo-5-chloroiodobenzene

CAS: 13101-40-1

3-Bromo-5-chloroiodobenzene

Purity: 99%

Molecular weight: 317.35g/mol

Ref: 54-OR400623

1-Bromo-3-chloro-5-iodobenzene

CAS: 13101-40-1

Formula: C₆H₃BrClI

Purity: 95%

Color and Shape: Solid

Molecular weight: 317.35

Ref: 10-F078356