CAS 13101-89-8
:2-Fluoro-6-methoxynaphthalene
Description:
2-Fluoro-6-methoxynaphthalene is an organic compound characterized by its naphthalene backbone, which is a polycyclic aromatic hydrocarbon. The presence of a fluorine atom at the second position and a methoxy group (-OCH3) at the sixth position of the naphthalene ring significantly influences its chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It exhibits moderate solubility in organic solvents, making it useful in various chemical applications, including as an intermediate in organic synthesis and in the development of pharmaceuticals. The fluorine substituent can enhance the compound's reactivity and stability, while the methoxy group can affect its electronic properties and polarity. Additionally, 2-Fluoro-6-methoxynaphthalene may exhibit interesting photophysical properties, making it a candidate for studies in materials science and organic electronics. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C11H9FO
InChI:InChI=1S/C11H9FO/c1-13-11-5-3-8-6-10(12)4-2-9(8)7-11/h2-7H,1H3
InChI key:InChIKey=UJQOYDMIMQIDBY-UHFFFAOYSA-N
SMILES:O(C)C1=CC2=C(C=C(F)C=C2)C=C1
Synonyms:- Naphthalene, 2-fluoro-6-methoxy-
- Naphthalene, 2-fluoro-6-methoxy- (8CI,9CI)
- 2-Fluoro-6-methoxynaphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
