
CAS 13102-93-7
:3-(2-Naphthalenylmethylene)-1(3H)-isobenzofuranone
Description:
3-(2-Naphthalenylmethylene)-1(3H)-isobenzofuranone, identified by its CAS number 13102-93-7, is an organic compound characterized by its complex structure, which includes a naphthalene moiety and an isobenzofuranone framework. This compound typically exhibits properties associated with aromatic systems, such as stability and potential for π-π stacking interactions due to its conjugated double bonds. It may display fluorescence, making it of interest in various applications, including organic electronics and photonic devices. The presence of the naphthyl group can enhance its solubility in organic solvents, while the isobenzofuranone core may contribute to its reactivity and potential biological activity. As with many organic compounds, its behavior can be influenced by environmental factors such as temperature and solvent polarity. Overall, this compound's unique structural features suggest potential utility in materials science and medicinal chemistry, although specific applications would depend on further research into its properties and interactions.
Formula:C19H12O2
InChI:InChI=1S/C19H12O2/c20-19-17-8-4-3-7-16(17)18(21-19)12-13-9-10-14-5-1-2-6-15(14)11-13/h1-12H
InChI key:InChIKey=SXVPWSRPVGNBJE-UHFFFAOYSA-N
SMILES:C(=C1C=2C(C(=O)O1)=CC=CC2)C3=CC4=C(C=C3)C=CC=C4
Synonyms:- 3-(2-Naphthalenylmethylene)-1(3H)-isobenzofuranone
- 1(3H)-Isobenzofuranone, 3-(2-naphthalenylmethylene)-
- Phthalide, 3-(2-naphthylmethylene)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
