CAS 131023-43-3
:carbazole-1-acetic acid
Description:
Carbazole-1-acetic acid is an organic compound characterized by its structure, which includes a carbazole moiety—a fused ring system consisting of a dibenzopyrrole framework—attached to an acetic acid functional group. This compound typically exhibits properties associated with both aromatic compounds and carboxylic acids, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the carboxylic acid group. Carbazole derivatives are known for their applications in organic electronics, particularly in light-emitting diodes and photovoltaic cells, due to their electronic properties. Additionally, carbazole-1-acetic acid may exhibit biological activity, making it of interest in medicinal chemistry. Its synthesis often involves the functionalization of the carbazole ring, and it can be characterized using techniques such as NMR spectroscopy and mass spectrometry. Overall, carbazole-1-acetic acid represents a versatile compound with potential applications in various fields, including materials science and pharmaceuticals.
Formula:C14H11NO2
InChI:InChI=1/C14H11NO2/c16-13(17)8-9-4-3-6-11-10-5-1-2-7-12(10)15-14(9)11/h1-7,15H,8H2,(H,16,17)
SMILES:c1ccc2c(c1)c1cccc(CC(=O)O)c1[nH]2
Synonyms:- 9H-Carbazole-1-acetic acid
- 9H-carbazol-1-ylacetic acid
- Carbazole-1-acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(9H-Carbazol-1-yl)acetic Acid
CAS:Controlled ProductFormula:C14H11NO2Color and Shape:NeatMolecular weight:225.2432-(9H-Carbazol-1-yl)acetic acid
CAS:2-(9H-Carbazol-1-yl)acetic acid (2CBA) is a fluorescent derivative that can be used as an analytical method for the determination of reaction intermediates in human serum. The fluorescence detector is on-line and it can be used to measure the kinetic of fluorescence emission. 2CBA has been used to study the environmental exposure of pharmaceutical drugs and the effect on nanomaterials in wastewater treatment. It has also been shown to have radiation cleavage properties, which makes it useful for determining whether a sample contains radioactive materials.Formula:C14H11NO2Purity:Min. 95%Molecular weight:225.24 g/mol


