
CAS 131028-06-3
:Piperazine, 1-(2-ethoxyethyl)-4-ethyl-
Description:
Piperazine, 1-(2-ethoxyethyl)-4-ethyl- is a chemical compound that belongs to the piperazine class, which is characterized by a six-membered ring containing two nitrogen atoms at opposite positions. This specific derivative features an ethyl group and an ethoxyethyl substituent, which can influence its solubility and reactivity. Generally, piperazine derivatives are known for their potential pharmacological activities, including anxiolytic, antidepressant, and antipsychotic effects. The presence of the ethoxyethyl group may enhance lipophilicity, potentially affecting the compound's ability to cross biological membranes. In terms of physical properties, piperazine derivatives typically exhibit moderate to high boiling points and may be soluble in polar solvents due to the presence of nitrogen atoms. Safety and handling precautions are essential, as many piperazine derivatives can be irritants or toxic in certain concentrations. As with any chemical substance, thorough characterization through methods such as NMR, IR spectroscopy, and mass spectrometry is crucial for understanding its properties and potential applications.
Formula:C10H22N2O
InChI:InChI=1S/C10H22N2O/c1-3-11-5-7-12(8-6-11)9-10-13-4-2/h3-10H2,1-2H3
InChI key:InChIKey=CJARCZGMLYGCMS-UHFFFAOYSA-N
SMILES:C(COCC)N1CCN(CC)CC1
Synonyms:- Piperazine, 1-(2-ethoxyethyl)-4-ethyl-
- 1-(2-Ethoxyethyl)-4-ethylpiperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.