CAS 131028-54-1

[4-[2-(DIMETHYLAMINO)ETHOXY]PHENYL]METHANOL

Description:

The chemical substance known as [4-[2-(dimethylamino)ethoxy]phenyl]methanol, with the CAS number 131028-54-1, is characterized by its complex organic structure, which includes a phenolic moiety and a dimethylamino group. This compound typically exhibits properties associated with both alcohols and amines, such as solubility in polar solvents due to the presence of hydroxyl (-OH) and amino (-NH) functional groups. It may display moderate to high polarity, influencing its interactions in biological systems and potential applications in pharmaceuticals or as a chemical intermediate. The dimethylamino group can impart basicity, affecting the compound's reactivity and ability to form salts. Additionally, the ethoxy linkage contributes to its overall hydrophobic character, which can modulate its bioavailability and permeability through biological membranes. Overall, this compound's unique structural features suggest potential utility in medicinal chemistry, particularly in the design of drug candidates targeting specific biological pathways.

Formula: C₁₁H₁₇NO₂

InChI: InChI=1/C11H17NO2/c1-12(2)7-8-14-11-5-3-10(9-13)4-6-11/h3-6,13H,7-9H2,1-2H3

SMILES: CN(C)CCOc1ccc(cc1)CO

Synonyms:

• {4-[2-(Dimethylamino)ethoxy]phenyl}methanol 97%

Benzenemethanol,4-[2-(dimethylamino)ethoxy]-

CAS: 131028-54-1

Formula: C₁₁H₁₇NO₂

Purity: 95%

Molecular weight: 195.2582

Ref: IN-DA0080LA

{4-[2-(Dimethylamino)ethoxy]phenyl}methanol

CAS: 131028-54-1

{4-[2-(Dimethylamino)ethoxy]phenyl}methanol

Purity: ≥95%

Color and Shape: Oil

Molecular weight: 195.26g/mol

Ref: 54-OR9618

{4-[2-(dimethylamino)ethoxy]phenyl}methanol

CAS: 131028-54-1

Formula: C₁₁H₁₇NO₂

Purity: 95%

Molecular weight: 195.262

Ref: 10-F518953