CAS 13103-40-7

(Tetrahydro-pyran-2-yl)acetic acid

Description:

(Tetrahydro-pyran-2-yl)acetic acid, with the CAS number 13103-40-7, is an organic compound characterized by the presence of a tetrahydropyran ring and an acetic acid functional group. This compound features a six-membered cyclic ether structure, which contributes to its stability and solubility in various solvents. The acetic acid moiety imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The compound is typically colorless to pale yellow and may exhibit a mild odor. Due to the presence of both ether and carboxylic acid functionalities, it can engage in hydrogen bonding, influencing its physical properties such as boiling point and solubility. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, (Tetrahydro-pyran-2-yl)acetic acid is a versatile compound with potential utility in various chemical applications.

Formula: C₇H₁₂O₃

InChI: InChI=1/C7H12O3/c8-7(9)5-6-3-1-2-4-10-6/h6H,1-5H2,(H,8,9)

SMILES: C1CCOC(C1)CC(=O)O

Synonyms:

• 2H-pyran-2-acetic acid, tetrahydro-
• tetrahydro-2H-pyran-2-ylacetic acid

2-(Tetrahydro-2H-pyran-2-yl)acetic acid

CAS: 13103-40-7

Formula: C₇H₁₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 144.1684

Ref: IN-DA0073EP

2-(Tetrahydro-2H-pyran-2-yl)acetic acid

CAS: 13103-40-7

2-(Tetrahydro-2H-pyran-2-yl)acetic acid

Purity: 98%

Molecular weight: 144.17g/mol

Ref: 54-OR75725

(Tetrahydro-pyran-2-yl)-acetic acid

CAS: 13103-40-7

Formula: C₇H₁₂O₃

Purity: 97%

Color and Shape: Solid, Low Melting Solid

Molecular weight: 144.17

Ref: 10-F058937

(Tetrahydro-pyran-2-yl)-acetic acid

CAS: 13103-40-7

Tetrahydro-pyran-2-yl)-acetic acid is an unsaturated acetic acid that can be synthesized by esters of tetrahydro-pyran-2-yl)acetic acid. Tetrahydro-pyran-2-yl)-acetic acid is produced by the catalyzed cyclization of ethyl acetoacetate and pivalic acid chloride. The heptahydrate form has been shown to undergo hydrolysis in aqueous solution to produce the monohydrated form, which is soluble in water. This compound has been shown to react with benzene, acetone, and ethyl acetoacetate in the presence of a Lewis acid catalyst to form substituted tetrahydropyrans.

Formula: C₇H₁₂O₃

Purity: Min. 95%

Molecular weight: 144.17 g/mol

Ref: 3D-NAA10340