CAS 1310379-36-2

4-Chloro-1-methyl-1H-pyrazole-5-acetic acid

Description:

4-Chloro-1-methyl-1H-pyrazole-5-acetic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a chlorine atom at the 4-position and a methyl group at the 1-position contributes to its unique reactivity and properties. This compound features an acetic acid functional group, which imparts acidic characteristics and enhances its solubility in polar solvents. It is typically used in various chemical syntheses and may have applications in pharmaceuticals or agrochemicals due to its potential biological activity. The compound's molecular structure allows for various interactions, making it a subject of interest in medicinal chemistry. Additionally, its stability and reactivity can be influenced by the substituents on the pyrazole ring, which can affect its behavior in different chemical environments. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₆H₇ClN₂O₂

InChI: InChI=1S/C6H7ClN2O2/c1-9-5(2-6(10)11)4(7)3-8-9/h3H,2H2,1H3,(H,10,11)

InChI key: InChIKey=KEKJAYNFSZXSDC-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1=C(Cl)C=NN1C

Synonyms:

• 4-Chloro-1-methyl-1H-pyrazole-5-acetic acid
• 1H-Pyrazole-5-acetic acid, 4-chloro-1-methyl-

2-(4-Chloro-1-methyl-1H-pyrazol-5-yl)acetic acid

CAS: 1310379-36-2

Versatile small molecule scaffold

Formula: C₆H₇ClN₂O₂

Purity: Min. 95%

Molecular weight: 174.58 g/mol

Ref: 3D-KCC37936