CAS 1310379-37-3

3-(Chloromethyl)-5-cyclopropyl-1-methyl-1H-pyrazole

Description:

3-(Chloromethyl)-5-cyclopropyl-1-methyl-1H-pyrazole is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a chloromethyl group at the 3-position and a cyclopropyl group at the 5-position contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The methyl group at the 1-position enhances its lipophilicity, which may influence its biological activity. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in drug development. Its molecular structure suggests potential interactions with biological targets, and the chloromethyl group can serve as a reactive site for further functionalization. As with many pyrazole derivatives, it may possess anti-inflammatory, analgesic, or other therapeutic effects, warranting investigation into its efficacy and safety in various applications. Proper handling and safety measures should be observed due to the presence of the chloromethyl group, which can be reactive.

Formula: C₈H₁₁ClN₂

InChI: InChI=1S/C8H11ClN2/c1-11-8(6-2-3-6)4-7(5-9)10-11/h4,6H,2-3,5H2,1H3

InChI key: InChIKey=RNPYHJOQHDMNJZ-UHFFFAOYSA-N

SMILES: CN1C(=CC(CCl)=N1)C2CC2

Synonyms:

• 3-(Chloromethyl)-5-cyclopropyl-1-methyl-1H-pyrazole
• 1H-Pyrazole, 3-(chloromethyl)-5-cyclopropyl-1-methyl-