CymitQuimica logo

CAS 1310383-03-9

:

1-[6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3-pyrrolidinol

Description:
1-[6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3-pyrrolidinol is a chemical compound characterized by its complex structure, which includes a pyridinyl group and a pyrrolidinol moiety. The presence of the dioxaborolane ring contributes to its potential reactivity, particularly in organoboron chemistry, where such compounds are often utilized as intermediates or reagents in various synthetic applications. The tetramethyl substitution enhances its steric properties, which can influence its reactivity and solubility in organic solvents. This compound may exhibit interesting biological activities due to the presence of the pyridine and pyrrolidine rings, which are common motifs in pharmaceuticals. Additionally, its unique structure may allow for specific interactions with biological targets, making it a candidate for further research in medicinal chemistry. Overall, the compound's characteristics suggest potential utility in both synthetic and biological contexts, warranting further investigation into its properties and applications.
Formula:C15H23BN2O3
InChI:InChI=1S/C15H23BN2O3/c1-14(2)15(3,4)21-16(20-14)12-6-5-7-13(17-12)18-9-8-11(19)10-18/h5-7,11,19H,8-10H2,1-4H3
InChI key:InChIKey=NNGXFSAATAXHSX-UHFFFAOYSA-N
SMILES:CC1(C)OB(C=2N=C(C=CC2)N3CC(O)CC3)OC1(C)C
Synonyms:
  • 3-Pyrrolidinol, 1-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-
  • 1-[6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3-pyrrolidinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.