CymitQuimica logo

CAS 1310383-08-4

:

1,1-Dimethylethyl N-[6-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]carbamate

Description:
1,1-Dimethylethyl N-[6-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]carbamate, identified by its CAS number 1310383-08-4, is a chemical compound characterized by its complex structure, which includes a pyridine ring, a carbamate functional group, and a boron-containing moiety. This compound typically exhibits properties associated with both organic and organoboron chemistry, making it of interest in various applications, including medicinal chemistry and agrochemicals. The presence of the methoxy group and the bulky dimethyl groups suggests potential for specific interactions in biological systems, possibly influencing its solubility and reactivity. Additionally, the dioxaborolane structure may confer unique properties related to coordination chemistry and reactivity with nucleophiles. Overall, this compound's unique structural features may contribute to its potential utility in synthetic applications or as a bioactive agent, although specific biological activity and reactivity would require further investigation through empirical studies.
Formula:C17H27BN2O5
InChI:InChI=1S/C17H27BN2O5/c1-15(2,3)23-14(21)19-11-9-10-12(22-8)20-13(11)18-24-16(4,5)17(6,7)25-18/h9-10H,1-8H3,(H,19,21)
InChI key:InChIKey=BSSLDLWQFCATAP-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1=C(N=C(OC)C=C1)B2OC(C)(C)C(C)(C)O2
Synonyms:
  • 1,1-Dimethylethyl N-[6-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]carbamate
  • Carbamic acid, N-[6-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.