CymitQuimica logo

CAS 1310383-09-5

:

B-1H-Pyrrolo[2,3-b]pyridin-6-ylboronic acid

Description:
B-1H-Pyrrolo[2,3-b]pyridin-6-ylboronic acid is a boronic acid derivative characterized by its unique bicyclic structure, which includes a pyrrole and pyridine moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and organic synthesis. The presence of the boronic acid functional group allows for potential interactions with biological targets, particularly in the context of drug development. Additionally, its structural features may contribute to specific reactivity patterns, such as Suzuki coupling reactions, which are valuable in constructing complex organic molecules. The compound is likely to be a solid at room temperature and may exhibit moderate solubility in polar solvents. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, B-1H-Pyrrolo[2,3-b]pyridin-6-ylboronic acid represents a versatile building block in chemical synthesis and pharmaceutical research.
Formula:C7H7BN2O2
InChI:InChI=1S/C7H7BN2O2/c11-8(12)6-2-1-5-3-4-9-7(5)10-6/h1-4,11-12H,(H,9,10)
InChI key:InChIKey=ABXAFNCFVWHRHU-UHFFFAOYSA-N
SMILES:B(O)(O)C=1N=C2C(=CC1)C=CN2
Synonyms:
  • Boronic acid, B-1H-pyrrolo[2,3-b]pyridin-6-yl-
  • 1H-Pyrrolo[2,3-b]pyridin-6-ylboronic acid
  • B-1H-Pyrrolo[2,3-b]pyridin-6-ylboronic acid
  • [1H-Pyrrolo[2,3-b]pyridin-6-yl]boronic acid
  • (1H-Pyrrolo[2,3-b]pyridin-6-yl)boronicacid
  • 1H-PYRROLO[2,3-B]PYRIDINE-6-BORONIC ACID
  • 7-Azaindole-6-boronic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.