CymitQuimica logo

CAS 1310383-55-1

:

1,1-Dimethylethyl N-[4-methyl-3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate

Description:
1,1-Dimethylethyl N-[4-methyl-3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate, identified by its CAS number 1310383-55-1, is a complex organic compound characterized by its unique structural features. It contains a carbamate functional group, which is known for its role in various biological activities and applications in pharmaceuticals. The presence of a pyridine ring contributes to its aromatic properties, while the nitro and boron-containing moieties enhance its reactivity and potential for forming coordination complexes. The bulky dimethyl groups provide steric hindrance, which can influence the compound's solubility and interaction with biological targets. This compound may exhibit specific biological activities, making it of interest in medicinal chemistry and agrochemical applications. Its synthesis and stability are influenced by the presence of the dioxaborolane group, which is known for its utility in organic synthesis and as a boron source in various reactions. Overall, this compound represents a blend of functional groups that may offer diverse applications in chemical research and development.
Formula:C17H26BN3O6
InChI:InChI=1S/C17H26BN3O6/c1-10-11(18-26-16(5,6)17(7,8)27-18)9-19-13(12(10)21(23)24)20-14(22)25-15(2,3)4/h9H,1-8H3,(H,19,20,22)
InChI key:InChIKey=AJVYLWNNAJGBKW-UHFFFAOYSA-N
SMILES:CC=1C(B2OC(C)(C)C(C)(C)O2)=CN=C(NC(OC(C)(C)C)=O)C1N(=O)=O
Synonyms:
  • 1,1-Dimethylethyl N-[4-methyl-3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate
  • Carbamic acid, N-[4-methyl-3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.