CymitQuimica logo

CAS 1310383-72-2

:

Description:
The chemical substance with the CAS number 1310383-72-2 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds with unique CAS numbers can exhibit a range of properties, including molecular weight, solubility, boiling and melting points, and reactivity, which are influenced by their molecular structure. Such substances may be used in various applications, including pharmaceuticals, agrochemicals, or industrial processes. To obtain precise characteristics, including safety data, handling instructions, and potential applications, it is advisable to consult specialized chemical databases, safety data sheets (SDS), or scientific literature. Additionally, the compound's behavior in different environments, such as its stability under various conditions and its interactions with other chemicals, would also be essential for understanding its practical uses and safety considerations.
Formula:C15H28BNO2·C2HF3O2
InChI:InChI=1/C15H28BNO2.C2HF3O2/c1-9(2)6-13(17)16-18-12-8-10-7-11(14(10,3)4)15(12,5)19-16;3-2(4,5)1(6)7/h9-13H,6-8,17H2,1-5H3;(H,6,7)/t10-,11-,12-,13+,15+;/s2
InChI key:InChIKey=SRFQKJZNJYTMNI-ZFZSXQSPNA-N
SMILES:C[C@]12[C@]3(C(C)(C)[C@](C3)(C[C@]1(OB([C@H](CC(C)C)N)O2)[H])[H])[H].C(C(O)=O)(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.