CAS 1310384-00-9
:B-(6-Formyl-2-pyridinyl)boronic acid
Description:
B-(6-Formyl-2-pyridinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group and a pyridine ring with a formyl substituent. This compound typically exhibits properties associated with both boronic acids and pyridine derivatives, such as the ability to form reversible covalent bonds with diols, making it useful in various applications including organic synthesis and medicinal chemistry. The presence of the formyl group introduces reactivity, allowing for further functionalization and potential applications in the development of pharmaceuticals or agrochemicals. Additionally, the compound may exhibit moderate solubility in polar solvents due to the presence of the boronic acid group, while the pyridine ring contributes to its aromatic character and potential for coordination with metal ions. Overall, B-(6-Formyl-2-pyridinyl)boronic acid is a versatile building block in organic synthesis, particularly in the context of Suzuki coupling reactions and other cross-coupling methodologies.
Formula:C6H6BNO3
InChI:InChI=1S/C6H6BNO3/c9-4-5-2-1-3-6(8-5)7(10)11/h1-4,10-11H
InChI key:InChIKey=JXILAYGCHAABTF-UHFFFAOYSA-N
SMILES:B(O)(O)C=1N=C(C=O)C=CC1
Synonyms:- (6-Formylpyridin-2-yl)boronic acid
- Boronic acid, B-(6-formyl-2-pyridinyl)-
- B-(6-Formyl-2-pyridinyl)boronic acid
- JXILAYGCHAABTF-UHFFFAOYSA-N
- 6-ForMylpyridine-2-boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
