CAS 1310384-01-0
:3-Methyl-5-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Description:
3-Methyl-5-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a methyl group and a nitro group, as well as a boron-containing moiety. The presence of the nitro group typically imparts electrophilic characteristics, making the compound potentially reactive in various chemical reactions. The boron-containing group, specifically the dioxaborolane, is known for its role in organoboron chemistry, often utilized in cross-coupling reactions and as a reagent in organic synthesis. This compound may exhibit properties such as solubility in organic solvents, and its reactivity can be influenced by the electron-withdrawing nature of the nitro group and the steric hindrance from the tetramethyl substituents. Overall, this compound could be of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its unique functional groups and potential reactivity.
Formula:C12H17BN2O4
InChI:InChI=1S/C12H17BN2O4/c1-8-6-9(15(16)17)7-14-10(8)13-18-11(2,3)12(4,5)19-13/h6-7H,1-5H3
InChI key:InChIKey=VWWJGSFCECTYIY-UHFFFAOYSA-N
SMILES:CC1=C(N=CC(N(=O)=O)=C1)B2OC(C)(C)C(C)(C)O2
Synonyms:- 3-Methyl-5-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
- Pyridine, 3-methyl-5-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Methyl-5-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
CAS:Formula:C12H17BN2O4Molecular weight:264.0854
