CAS 1310384-29-2

B-[6-(1,3-Dioxopropyl)-3-pyridinyl]boronic acid

Description:

B-[6-(1,3-Dioxopropyl)-3-pyridinyl]boronic acid is a boronic acid derivative characterized by the presence of a pyridine ring and a dioxopropyl substituent. Boronic acids are known for their ability to form reversible covalent bonds with diols, making them valuable in various applications, including organic synthesis and medicinal chemistry. This compound features a boron atom bonded to a hydroxyl group and a pyridine moiety, which can enhance its reactivity and solubility in polar solvents. The dioxopropyl group introduces additional functional groups that may participate in further chemical reactions or interactions. Typically, boronic acids are utilized in Suzuki coupling reactions, which are pivotal in forming carbon-carbon bonds in the synthesis of complex organic molecules. The specific structure of B-[6-(1,3-Dioxopropyl)-3-pyridinyl]boronic acid suggests potential applications in drug development, particularly in targeting biological pathways involving carbohydrates or in the design of sensors due to its ability to interact with biomolecules. As with many boronic acids, careful handling and storage are recommended due to their sensitivity to moisture and air.

Formula: C₈H₈BNO₄

InChI: InChI=1S/C8H8BNO4/c11-4-3-8(12)7-2-1-6(5-10-7)9(13)14/h1-2,4-5,13-14H,3H2

InChI key: InChIKey=DMYNTPHGXOWLGX-UHFFFAOYSA-N

SMILES: C(CC=O)(=O)C1=CC=C(B(O)O)C=N1

Synonyms:

• Boronic acid, B-[6-(1,3-dioxopropyl)-3-pyridinyl]-
• B-[6-(1,3-Dioxopropyl)-3-pyridinyl]boronic acid

(6-(3-Oxopropanoyl)pyridin-3-yl)boronic acid

CAS: 1310384-29-2

Formula: C₈H₈BNO₄

Molecular weight: 192.9644

Ref: IN-DA009XU4